C26H34FN3O6S — CID 91491069
tert-butyl (5S)-7-[2-(ethylsulfonylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-5-yl]-5-hydroxy-3-oxohept-6-enoate (PubChem CID 91491069) has the molecular formula C26H34FN3O6S and a molecular weight of 535.64 g/mol. Its IUPAC name is tert-butyl (5S)-7-[2-(ethylsulfonylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-5-yl]-5-hydroxy-3-oxohept-6-enoate.
| Compound Name | tert-butyl (5S)-7-[2-(ethylsulfonylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-5-yl]-5-hydroxy-3-oxohept-6-enoate |
|---|---|
| PubChem CID | 91491069 |
| Molecular Formula | C26H34FN3O6S |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | tert-butyl (5S)-7-[2-(ethylsulfonylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-5-yl]-5-hydroxy-3-oxohept-6-enoate |
| SMILES | CCS(=O)(=O)Nc1nc(-c2ccc(F)cc2)c(C=C[C@@H](O)CC(=O)CC(=O)OC(C)(C)C)c(C(C)C)n1 |
| InChI | InChI=1S/C26H34FN3O6S/c1-7-37(34,35)30-25-28-23(16(2)3)21(24(29-25)17-8-10-18(27)11-9-17)13-12-19(31)14-20(32)15-22(33)36-26(4,5)6/h8-13,16,19,31H,7,14-15H2,1-6H3,(H,28,29,30)/t19-/m1/s1 |
| InChIKey | ZFAYNVNZAJCEFU-LJQANCHMSA-N |
| XLogP | 4.23 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|