C21H26FN3O6S — CID 45038891
(E,3R,5S)-7-[4-(4-fluorophenyl)-6-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-2-(methanesulfonamido)pyrimidin-5-yl]-3,5-dihydroxyhept-6-enoic acid (PubChem CID 45038891) has the molecular formula C21H26FN3O6S and a molecular weight of 473.56 g/mol. Its IUPAC name is (E,3R,5S)-7-[4-(4-fluorophenyl)-6-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-2-(methanesulfonamido)pyrimidin-5-yl]-3,5-dihydroxyhept-6-enoic acid.
| Compound Name | (E,3R,5S)-7-[4-(4-fluorophenyl)-6-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-2-(methanesulfonamido)pyrimidin-5-yl]-3,5-dihydroxyhept-6-enoic acid |
|---|---|
| PubChem CID | 45038891 |
| Molecular Formula | C21H26FN3O6S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | (E,3R,5S)-7-[4-(4-fluorophenyl)-6-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-2-(methanesulfonamido)pyrimidin-5-yl]-3,5-dihydroxyhept-6-enoic acid |
| SMILES | [2H]C([2H])([2H])C(c1nc(NS(C)(=O)=O)nc(-c2ccc(F)cc2)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C21H26FN3O6S/c1-12(2)19-17(9-8-15(26)10-16(27)11-18(28)29)20(13-4-6-14(22)7-5-13)24-21(23-19)25-32(3,30)31/h4-9,12,15-16,26-27H,10-11H2,1-3H3,(H,28,29)(H,23,24,25)/b9-8+/t15-,16-/m1/s1/i1D3,2D3 |
| InChIKey | DJUKMHIJCDJSIJ-QZOLWRBTSA-N |
| XLogP | 2.38 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |