C21H28FN3O4S — CID 140795485
N-[5-[(E)-1,2-dihydroxyhex-1-enyl]-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-2-yl]ethanesulfonamide (PubChem CID 140795485) has the molecular formula C21H28FN3O4S and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[5-[(E)-1,2-dihydroxyhex-1-enyl]-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-2-yl]ethanesulfonamide.
| Compound Name | N-[5-[(E)-1,2-dihydroxyhex-1-enyl]-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 140795485 |
| Molecular Formula | C21H28FN3O4S |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-[5-[(E)-1,2-dihydroxyhex-1-enyl]-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-2-yl]ethanesulfonamide |
| SMILES | CCCC/C(O)=C(\O)c1c(-c2ccc(F)cc2)nc(NS(=O)(=O)CC)nc1C(C)C |
| InChI | InChI=1S/C21H28FN3O4S/c1-5-7-8-16(26)20(27)17-18(13(3)4)23-21(25-30(28,29)6-2)24-19(17)14-9-11-15(22)12-10-14/h9-13,26-27H,5-8H2,1-4H3,(H,23,24,25)/b20-16+ |
| InChIKey | DIPFPFIIICRJAU-CAPFRKAQSA-N |
| XLogP | 5.14 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|