C34H34FN3O2PS+ — CID 87105293
[2-(ethylsulfonylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-5-yl]methyl-triphenylphosphanium (PubChem CID 87105293) has the molecular formula C34H34FN3O2PS+ and a molecular weight of 598.70 g/mol. Its IUPAC name is [2-(ethylsulfonylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-5-yl]methyl-triphenylphosphanium.
| Compound Name | [2-(ethylsulfonylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-5-yl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 87105293 |
| Molecular Formula | C34H34FN3O2PS+ |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | [2-(ethylsulfonylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-5-yl]methyl-triphenylphosphanium |
| SMILES | CCS(=O)(=O)Nc1nc(-c2ccc(F)cc2)c(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(C(C)C)n1 |
| InChI | InChI=1S/C34H34FN3O2PS/c1-4-42(39,40)38-34-36-32(25(2)3)31(33(37-34)26-20-22-27(35)23-21-26)24-41(28-14-8-5-9-15-28,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-23,25H,4,24H2,1-3H3,(H,36,37,38)/q+1 |
| InChIKey | PLGGNLDYVGVASM-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|