C30H46F4N3O4PS — CID 67240949
tributyl-[[2-(ethylsulfonylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-5-yl]methyl]phosphanium;2,2,2-trifluoroacetate (PubChem CID 67240949) has the molecular formula C30H46F4N3O4PS and a molecular weight of 651.75 g/mol. Its IUPAC name is tributyl-[[2-(ethylsulfonylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-5-yl]methyl]phosphanium;2,2,2-trifluoroacetate.
| Compound Name | tributyl-[[2-(ethylsulfonylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-5-yl]methyl]phosphanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67240949 |
| Molecular Formula | C30H46F4N3O4PS |
| Molecular Weight | 651.75 g/mol |
| Exact Mass | 651.29 |
| IUPAC Name | tributyl-[[2-(ethylsulfonylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-5-yl]methyl]phosphanium;2,2,2-trifluoroacetate |
| SMILES | CCCC[P+](CCCC)(CCCC)Cc1c(-c2ccc(F)cc2)nc(NS(=O)(=O)CC)nc1C(C)C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C28H46FN3O2PS.C2HF3O2/c1-7-11-18-35(19-12-8-2,20-13-9-3)21-25-26(22(5)6)30-28(32-36(33,34)10-4)31-27(25)23-14-16-24(29)17-15-23;3-2(4,5)1(6)7/h14-17,22H,7-13,18-21H2,1-6H3,(H,30,31,32);(H,6,7)/q+1;/p-1 |
| InChIKey | LMFOCXRSHGHPFV-UHFFFAOYSA-M |
| XLogP | 7.38 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.75 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|