C14H13FN4O — CID 139714652
2-(4-fluoro-2-methylphenyl)-4-(1-methyltetrazol-5-yl)penta-2,4-dienal (PubChem CID 139714652) has the molecular formula C14H13FN4O and a molecular weight of 272.28 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylphenyl)-4-(1-methyltetrazol-5-yl)penta-2,4-dienal.
| Compound Name | 2-(4-fluoro-2-methylphenyl)-4-(1-methyltetrazol-5-yl)penta-2,4-dienal |
|---|---|
| PubChem CID | 139714652 |
| Molecular Formula | C14H13FN4O |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-(4-fluoro-2-methylphenyl)-4-(1-methyltetrazol-5-yl)penta-2,4-dienal |
| SMILES | C=C(C=C(C=O)c1ccc(F)cc1C)c1nnnn1C |
| InChI | InChI=1S/C14H13FN4O/c1-9-7-12(15)4-5-13(9)11(8-20)6-10(2)14-16-17-18-19(14)3/h4-8H,2H2,1,3H3 |
| InChIKey | YGACSDBYSGZGIP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|