C18H18N3O2S+ — CID 171378726
N-[2-methoxy-4-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]phenyl]-N-methylnitrous amide (PubChem CID 171378726) has the molecular formula C18H18N3O2S+ and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[2-methoxy-4-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]phenyl]-N-methylnitrous amide.
| Compound Name | N-[2-methoxy-4-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]phenyl]-N-methylnitrous amide |
|---|---|
| PubChem CID | 171378726 |
| Molecular Formula | C18H18N3O2S+ |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[2-methoxy-4-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]phenyl]-N-methylnitrous amide |
| SMILES | COc1cc(/C=C/c2sc3ccccc3[n+]2C)ccc1N(C)N=O |
| InChI | InChI=1S/C18H18N3O2S/c1-20-15-6-4-5-7-17(15)24-18(20)11-9-13-8-10-14(21(2)19-22)16(12-13)23-3/h4-12H,1-3H3/q+1 |
| InChIKey | NQHITIJDPDWUFB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 45.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|