C16H13N2O2S+ — CID 5473528
3-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-benzothiazol-3-ium (PubChem CID 5473528) has the molecular formula C16H13N2O2S+ and a molecular weight of 297.36 g/mol. Its IUPAC name is 3-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-benzothiazol-3-ium.
| Compound Name | 3-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 5473528 |
| Molecular Formula | C16H13N2O2S+ |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-benzothiazol-3-ium |
| SMILES | C[n+]1c(/C=C/c2cccc([N+](=O)[O-])c2)sc2ccccc21 |
| InChI | InChI=1S/C16H13N2O2S/c1-17-14-7-2-3-8-15(14)21-16(17)10-9-12-5-4-6-13(11-12)18(19)20/h2-11H,1H3/q+1/b10-9+ |
| InChIKey | MEMPPCGVAMKFNC-MDZDMXLPSA-N |
| XLogP | 3.80 |
| TPSA | 47.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|