C20H20N3O2+ — CID 3711353
1,4,4-trimethyl-5-[2-(3-nitrophenyl)ethenyl]-3-phenylpyrazol-1-ium (PubChem CID 3711353) has the molecular formula C20H20N3O2+ and a molecular weight of 334.40 g/mol. Its IUPAC name is 1,4,4-trimethyl-5-[2-(3-nitrophenyl)ethenyl]-3-phenylpyrazol-1-ium.
| Compound Name | 1,4,4-trimethyl-5-[2-(3-nitrophenyl)ethenyl]-3-phenylpyrazol-1-ium |
|---|---|
| PubChem CID | 3711353 |
| Molecular Formula | C20H20N3O2+ |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1,4,4-trimethyl-5-[2-(3-nitrophenyl)ethenyl]-3-phenylpyrazol-1-ium |
| SMILES | C[N+]1=C(C=Cc2cccc([N+](=O)[O-])c2)C(C)(C)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C20H20N3O2/c1-20(2)18(13-12-15-8-7-11-17(14-15)23(24)25)22(3)21-19(20)16-9-5-4-6-10-16/h4-14H,1-3H3/q+1 |
| InChIKey | XFLOCZXHBNXDOG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|