C22H17IN2S3 — CID 158121845
2-[(E)-2-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]ethenyl]-3-ethyl-1,3-benzothiazol-3-ium iodide (PubChem CID 158121845) has the molecular formula C22H17IN2S3 and a molecular weight of 532.50 g/mol. Its IUPAC name is 2-[(E)-2-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]ethenyl]-3-ethyl-1,3-benzothiazol-3-ium iodide.
| Compound Name | 2-[(E)-2-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]ethenyl]-3-ethyl-1,3-benzothiazol-3-ium iodide |
|---|---|
| PubChem CID | 158121845 |
| Molecular Formula | C22H17IN2S3 |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 531.96 |
| IUPAC Name | 2-[(E)-2-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]ethenyl]-3-ethyl-1,3-benzothiazol-3-ium iodide |
| SMILES | CC[n+]1c(/C=C/c2ccc(-c3ccc4ncsc4c3)s2)sc2ccccc21.[I-] |
| InChI | InChI=1S/C22H17N2S3.HI/c1-2-24-18-5-3-4-6-20(18)27-22(24)12-9-16-8-11-19(26-16)15-7-10-17-21(13-15)25-14-23-17;/h3-14H,2H2,1H3;1H/q+1;/p-1 |
| InChIKey | QGJWRSAGAJJKHE-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|