About 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine
1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine (PubChem CID 107806474) has the molecular formula C16H18N2S2
and a molecular weight of 302.47 g/mol. Its IUPAC name is 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine |
| PubChem CID | 107806474 |
| Molecular Formula | C16H18N2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine |
| SMILES | CCNC(CC)c1ccc(-c2ccc3ncsc3c2)s1 |
| InChI | InChI=1S/C16H18N2S2/c1-3-12(17-4-2)15-8-7-14(20-15)11-5-6-13-16(9-11)19-10-18-13/h5-10,12,17H,3-4H2,1-2H3 |
| InChIKey | SETINTXBHCAERR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine?
The IUPAC name of 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine (CID 107806474) is 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine.
What is the SMILES notation for 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine?
The canonical SMILES for 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine is CCNC(CC)c1ccc(-c2ccc3ncsc3c2)s1.
What is the InChIKey of 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine?
The InChIKey is SETINTXBHCAERR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2S2/c1-3-12(17-4-2)15-8-7-14(20-15)11-5-6-13-16(9-11)19-10-18-13/h5-10,12,17H,3-4H2,1-2H3.
What are the key properties of 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine?
1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine has a molecular weight of 302.47 g/mol, XLogP of 5.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]-N-ethylpropan-1-amine is sourced from PubChem (CID 107806474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).