C17H19N2S+ — CID 16954
4-(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline (PubChem CID 16954) has the molecular formula C17H19N2S+ and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 16954 |
| Molecular Formula | C17H19N2S+ |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 4-(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline |
| SMILES | Cc1ccc2c(c1)sc(-c1ccc(N(C)C)cc1)[n+]2C |
| InChI | InChI=1S/C17H19N2S/c1-12-5-10-15-16(11-12)20-17(19(15)4)13-6-8-14(9-7-13)18(2)3/h5-11H,1-4H3/q+1 |
| InChIKey | FXEKRIDRIFBJOR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|