C12H14N2S3 — CID 7229
1,3-benzothiazol-2-yl N,N-diethylcarbamodithioate (PubChem CID 7229) has the molecular formula C12H14N2S3 and a molecular weight of 282.46 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl N,N-diethylcarbamodithioate.
| Compound Name | 1,3-benzothiazol-2-yl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 7229 |
| Molecular Formula | C12H14N2S3 |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 1,3-benzothiazol-2-yl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H14N2S3/c1-3-14(4-2)12(15)17-11-13-9-7-5-6-8-10(9)16-11/h5-8H,3-4H2,1-2H3 |
| InChIKey | LFMQNMXVVXHZCC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|