C14H8N2S4 — CID 8447
2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole (PubChem CID 8447) has the molecular formula C14H8N2S4 and a molecular weight of 332.50 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole.
| Compound Name | 2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 8447 |
| Molecular Formula | C14H8N2S4 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole |
| SMILES | c1ccc2sc(SSc3nc4ccccc4s3)nc2c1 |
| InChI | InChI=1S/C14H8N2S4/c1-3-7-11-9(5-1)15-13(17-11)19-20-14-16-10-6-2-4-8-12(10)18-14/h1-8H |
| InChIKey | AFZSMODLJJCVPP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|