C11H12INS — CID 158148527
2,4-dimethyl-3-phenyl-1,3-thiazol-3-ium iodide (PubChem CID 158148527) has the molecular formula C11H12INS and a molecular weight of 317.20 g/mol. Its IUPAC name is 2,4-dimethyl-3-phenyl-1,3-thiazol-3-ium iodide.
| Compound Name | 2,4-dimethyl-3-phenyl-1,3-thiazol-3-ium iodide |
|---|---|
| PubChem CID | 158148527 |
| Molecular Formula | C11H12INS |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 2,4-dimethyl-3-phenyl-1,3-thiazol-3-ium iodide |
| SMILES | Cc1csc(C)[n+]1-c1ccccc1.[I-] |
| InChI | InChI=1S/C11H12NS.HI/c1-9-8-13-10(2)12(9)11-6-4-3-5-7-11;/h3-8H,1-2H3;1H/q+1;/p-1 |
| InChIKey | FUUSBVGKMHMDDR-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|