C11H9IN2S — CID 155288892
3-methyl-[1,3]thiazolo[3,2-c]quinazolin-4-ium iodide (PubChem CID 155288892) has the molecular formula C11H9IN2S and a molecular weight of 328.18 g/mol. Its IUPAC name is 3-methyl-[1,3]thiazolo[3,2-c]quinazolin-4-ium iodide.
| Compound Name | 3-methyl-[1,3]thiazolo[3,2-c]quinazolin-4-ium iodide |
|---|---|
| PubChem CID | 155288892 |
| Molecular Formula | C11H9IN2S |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 3-methyl-[1,3]thiazolo[3,2-c]quinazolin-4-ium iodide |
| SMILES | Cc1csc2c3ccccc3nc[n+]12.[I-] |
| InChI | InChI=1S/C11H9N2S.HI/c1-8-6-14-11-9-4-2-3-5-10(9)12-7-13(8)11;/h2-7H,1H3;1H/q+1;/p-1 |
| InChIKey | RRPCETSDKANZIA-UHFFFAOYSA-M |
| XLogP | -0.65 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|