About 4-(disulfanyl)quinoline
4-(disulfanyl)quinoline (PubChem CID 123289875) has the molecular formula C9H7NS2
and a molecular weight of 193.30 g/mol. Its IUPAC name is 4-(disulfanyl)quinoline.
Molecular Properties
| Compound Name | 4-(disulfanyl)quinoline |
| PubChem CID | 123289875 |
| Molecular Formula | C9H7NS2 |
| Molecular Weight | 193.30 g/mol |
| Exact Mass | 193.00 |
| IUPAC Name | 4-(disulfanyl)quinoline |
| SMILES | SSc1ccnc2ccccc12 |
| InChI | InChI=1S/C9H7NS2/c11-12-9-5-6-10-8-4-2-1-3-7(8)9/h1-6,11H |
| InChIKey | LDYQIGZEBRRWDP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(disulfanyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(disulfanyl)quinoline?
The IUPAC name of 4-(disulfanyl)quinoline (CID 123289875) is 4-(disulfanyl)quinoline.
What is the SMILES notation for 4-(disulfanyl)quinoline?
The canonical SMILES for 4-(disulfanyl)quinoline is SSc1ccnc2ccccc12.
What is the InChIKey of 4-(disulfanyl)quinoline?
The InChIKey is LDYQIGZEBRRWDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS2/c11-12-9-5-6-10-8-4-2-1-3-7(8)9/h1-6,11H.
What are the key properties of 4-(disulfanyl)quinoline?
4-(disulfanyl)quinoline has a molecular weight of 193.30 g/mol, XLogP of 3.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(disulfanyl)quinoline is sourced from PubChem (CID 123289875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).