About 4-(disulfanyl)cinnoline
4-(disulfanyl)cinnoline (PubChem CID 91084277) has the molecular formula C8H6N2S2
and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-(disulfanyl)cinnoline.
Molecular Properties
| Compound Name | 4-(disulfanyl)cinnoline |
| PubChem CID | 91084277 |
| Molecular Formula | C8H6N2S2 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 4-(disulfanyl)cinnoline |
| SMILES | SSc1cnnc2ccccc12 |
| InChI | InChI=1S/C8H6N2S2/c11-12-8-5-9-10-7-4-2-1-3-6(7)8/h1-5,11H |
| InChIKey | GJQCUHZAPGMROE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(disulfanyl)cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(disulfanyl)cinnoline?
The IUPAC name of 4-(disulfanyl)cinnoline (CID 91084277) is 4-(disulfanyl)cinnoline.
What is the SMILES notation for 4-(disulfanyl)cinnoline?
The canonical SMILES for 4-(disulfanyl)cinnoline is SSc1cnnc2ccccc12.
What is the InChIKey of 4-(disulfanyl)cinnoline?
The InChIKey is GJQCUHZAPGMROE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S2/c11-12-8-5-9-10-7-4-2-1-3-6(7)8/h1-5,11H.
What are the key properties of 4-(disulfanyl)cinnoline?
4-(disulfanyl)cinnoline has a molecular weight of 194.28 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(disulfanyl)cinnoline is sourced from PubChem (CID 91084277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).