About cinnoline
cinnoline (PubChem CID 9208) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol. Its IUPAC name is cinnoline.
Molecular Properties
| Compound Name | cinnoline |
| PubChem CID | 9208 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | cinnoline |
| SMILES | c1ccc2nnccc2c1 |
| InChI | InChI=1S/C8H6N2/c1-2-4-8-7(3-1)5-6-9-10-8/h1-6H |
| InChIKey | WCZVZNOTHYJIEI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnoline?
The IUPAC name of cinnoline (CID 9208) is cinnoline.
What is the SMILES notation for cinnoline?
The canonical SMILES for cinnoline is c1ccc2nnccc2c1.
What is the InChIKey of cinnoline?
The InChIKey is WCZVZNOTHYJIEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2/c1-2-4-8-7(3-1)5-6-9-10-8/h1-6H.
What are the key properties of cinnoline?
cinnoline has a molecular weight of 130.15 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cinnoline is sourced from PubChem (CID 9208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).