About 3,5-diphenylpyridazine
3,5-diphenylpyridazine (PubChem CID 10443943) has the molecular formula C16H12N2
and a molecular weight of 232.29 g/mol. Its IUPAC name is 3,5-diphenylpyridazine.
Molecular Properties
| Compound Name | 3,5-diphenylpyridazine |
| PubChem CID | 10443943 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3,5-diphenylpyridazine |
| SMILES | c1ccc(-c2cnnc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C16H12N2/c1-3-7-13(8-4-1)15-11-16(18-17-12-15)14-9-5-2-6-10-14/h1-12H |
| InChIKey | RTNPJCQBMCRDSE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-diphenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diphenylpyridazine?
The IUPAC name of 3,5-diphenylpyridazine (CID 10443943) is 3,5-diphenylpyridazine.
What is the SMILES notation for 3,5-diphenylpyridazine?
The canonical SMILES for 3,5-diphenylpyridazine is c1ccc(-c2cnnc(-c3ccccc3)c2)cc1.
What is the InChIKey of 3,5-diphenylpyridazine?
The InChIKey is RTNPJCQBMCRDSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2/c1-3-7-13(8-4-1)15-11-16(18-17-12-15)14-9-5-2-6-10-14/h1-12H.
What are the key properties of 3,5-diphenylpyridazine?
3,5-diphenylpyridazine has a molecular weight of 232.29 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diphenylpyridazine is sourced from PubChem (CID 10443943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).