C20H17F3N+ — CID 168892713
2,6-dimethyl-1-phenyl-4-[4-(trifluoromethyl)phenyl]pyridin-1-ium (PubChem CID 168892713) has the molecular formula C20H17F3N+ and a molecular weight of 328.36 g/mol. Its IUPAC name is 2,6-dimethyl-1-phenyl-4-[4-(trifluoromethyl)phenyl]pyridin-1-ium.
| Compound Name | 2,6-dimethyl-1-phenyl-4-[4-(trifluoromethyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 168892713 |
| Molecular Formula | C20H17F3N+ |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2,6-dimethyl-1-phenyl-4-[4-(trifluoromethyl)phenyl]pyridin-1-ium |
| SMILES | Cc1cc(-c2ccc(C(F)(F)F)cc2)cc(C)[n+]1-c1ccccc1 |
| InChI | InChI=1S/C20H17F3N/c1-14-12-17(16-8-10-18(11-9-16)20(21,22)23)13-15(2)24(14)19-6-4-3-5-7-19/h3-13H,1-2H3/q+1 |
| InChIKey | IWEDQWSBXOQDSY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|