C18H16Cl2N4 — CID 66694702
10-phenylphenazin-10-ium-2,8-diamine;chloride;hydrochloride (PubChem CID 66694702) has the molecular formula C18H16Cl2N4 and a molecular weight of 359.26 g/mol. Its IUPAC name is 10-phenylphenazin-10-ium-2,8-diamine;chloride;hydrochloride.
| Compound Name | 10-phenylphenazin-10-ium-2,8-diamine;chloride;hydrochloride |
|---|---|
| PubChem CID | 66694702 |
| Molecular Formula | C18H16Cl2N4 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 10-phenylphenazin-10-ium-2,8-diamine;chloride;hydrochloride |
| SMILES | Cl.Nc1ccc2nc3ccc(N)cc3[n+](-c3ccccc3)c2c1.[Cl-] |
| InChI | InChI=1S/C18H14N4.2ClH/c19-12-6-8-15-17(10-12)22(14-4-2-1-3-5-14)18-11-13(20)7-9-16(18)21-15;;/h1-11H,(H3,19,20);2*1H |
| InChIKey | VXEJYRGFBMPQMD-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|