C34H47P — CID 172805245
[2,3-bis(2-tert-butylphenyl)phenyl]-ditert-butylphosphane (PubChem CID 172805245) has the molecular formula C34H47P and a molecular weight of 486.72 g/mol. Its IUPAC name is [2,3-bis(2-tert-butylphenyl)phenyl]-ditert-butylphosphane.
| Compound Name | [2,3-bis(2-tert-butylphenyl)phenyl]-ditert-butylphosphane |
|---|---|
| PubChem CID | 172805245 |
| Molecular Formula | C34H47P |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | [2,3-bis(2-tert-butylphenyl)phenyl]-ditert-butylphosphane |
| SMILES | CC(C)(C)c1ccccc1-c1cccc(P(C(C)(C)C)C(C)(C)C)c1-c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C34H47P/c1-31(2,3)27-21-15-13-18-24(27)25-20-17-23-29(35(33(7,8)9)34(10,11)12)30(25)26-19-14-16-22-28(26)32(4,5)6/h13-23H,1-12H3 |
| InChIKey | RKNIYJPZBWKOPN-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|