C68H92O4P2 — CID 141242594
[2-bis(2,6-ditert-butylphenoxy)phosphanyl-3-phenylphenyl]-bis(2,6-ditert-butylphenoxy)phosphane (PubChem CID 141242594) has the molecular formula C68H92O4P2 and a molecular weight of 1035.43 g/mol. Its IUPAC name is [2-bis(2,6-ditert-butylphenoxy)phosphanyl-3-phenylphenyl]-bis(2,6-ditert-butylphenoxy)phosphane.
| Compound Name | [2-bis(2,6-ditert-butylphenoxy)phosphanyl-3-phenylphenyl]-bis(2,6-ditert-butylphenoxy)phosphane |
|---|---|
| PubChem CID | 141242594 |
| Molecular Formula | C68H92O4P2 |
| Molecular Weight | 1035.43 g/mol |
| Exact Mass | 1034.65 |
| IUPAC Name | [2-bis(2,6-ditert-butylphenoxy)phosphanyl-3-phenylphenyl]-bis(2,6-ditert-butylphenoxy)phosphane |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1OP(Oc1c(C(C)(C)C)cccc1C(C)(C)C)c1cccc(-c2ccccc2)c1P(Oc1c(C(C)(C)C)cccc1C(C)(C)C)Oc1c(C(C)(C)C)cccc1C(C)(C)C |
| InChI | InChI=1S/C68H92O4P2/c1-61(2,3)47-36-29-37-48(62(4,5)6)56(47)69-73(70-57-49(63(7,8)9)38-30-39-50(57)64(10,11)12)55-44-28-35-46(45-33-26-25-27-34-45)60(55)74(71-58-51(65(13,14)15)40-31-41-52(58)66(16,17)18)72-59-53(67(19,20)21)42-32-43-54(59)68(22,23)24/h25-44H,1-24H3 |
| InChIKey | XRIWETZJRBAYGM-UHFFFAOYSA-N |
| XLogP | 19.92 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.43 |
| LogP ≤ 5 | 19.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|