C20H26ClOP — CID 54014120
chloro-(2,6-ditert-butylphenoxy)-phenylphosphane (PubChem CID 54014120) has the molecular formula C20H26ClOP and a molecular weight of 348.85 g/mol. Its IUPAC name is chloro-(2,6-ditert-butylphenoxy)-phenylphosphane.
| Compound Name | chloro-(2,6-ditert-butylphenoxy)-phenylphosphane |
|---|---|
| PubChem CID | 54014120 |
| Molecular Formula | C20H26ClOP |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | chloro-(2,6-ditert-butylphenoxy)-phenylphosphane |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1OP(Cl)c1ccccc1 |
| InChI | InChI=1S/C20H26ClOP/c1-19(2,3)16-13-10-14-17(20(4,5)6)18(16)22-23(21)15-11-8-7-9-12-15/h7-14H,1-6H3 |
| InChIKey | KUKQRKNLEXBHBH-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|