C28H42FO3P — CID 67572261
bis(2,6-ditert-butylphenyl) fluoro phosphite (PubChem CID 67572261) has the molecular formula C28H42FO3P and a molecular weight of 476.61 g/mol. Its IUPAC name is bis(2,6-ditert-butylphenyl) fluoro phosphite.
| Compound Name | bis(2,6-ditert-butylphenyl) fluoro phosphite |
|---|---|
| PubChem CID | 67572261 |
| Molecular Formula | C28H42FO3P |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | bis(2,6-ditert-butylphenyl) fluoro phosphite |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1OP(OF)Oc1c(C(C)(C)C)cccc1C(C)(C)C |
| InChI | InChI=1S/C28H42FO3P/c1-25(2,3)19-15-13-16-20(26(4,5)6)23(19)30-33(32-29)31-24-21(27(7,8)9)17-14-18-22(24)28(10,11)12/h13-18H,1-12H3 |
| InChIKey | QXLAVTWJWUZRFL-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|