C14H6F8 — CID 134620901
1,2,3,4,5-pentafluoro-6-[2-methyl-3-(trifluoromethyl)phenyl]benzene (PubChem CID 134620901) has the molecular formula C14H6F8 and a molecular weight of 326.19 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2-methyl-3-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2-methyl-3-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 134620901 |
| Molecular Formula | C14H6F8 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2-methyl-3-(trifluoromethyl)phenyl]benzene |
| SMILES | Cc1c(-c2c(F)c(F)c(F)c(F)c2F)cccc1C(F)(F)F |
| InChI | InChI=1S/C14H6F8/c1-5-6(3-2-4-7(5)14(20,21)22)8-9(15)11(17)13(19)12(18)10(8)16/h2-4H,1H3 |
| InChIKey | CFDFYRJAQGKHCQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|