C36H37N3O — CID 137083100
2,4-ditert-butyl-6-[[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]iminomethyl]phenol (PubChem CID 137083100) has the molecular formula C36H37N3O and a molecular weight of 527.71 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137083100 |
| Molecular Formula | C36H37N3O |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 2,4-ditert-butyl-6-[[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccccc2-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H37N3O/c1-35(2,3)27-21-26(33(40)29(22-27)36(4,5)6)23-37-30-20-14-13-19-28(30)34-38-31(24-15-9-7-10-16-24)32(39-34)25-17-11-8-12-18-25/h7-23,40H,1-6H3,(H,38,39)/b37-23+ |
| InChIKey | KTLAMOBYQGVFKT-GUBAARJWSA-N |
| XLogP | 9.46 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|