C18H15ClN2O4 — CID 171715778
7-chloro-6-(3,5-dimethoxyanilino)-2-methylquinoline-5,8-dione (PubChem CID 171715778) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is 7-chloro-6-(3,5-dimethoxyanilino)-2-methylquinoline-5,8-dione.
| Compound Name | 7-chloro-6-(3,5-dimethoxyanilino)-2-methylquinoline-5,8-dione |
|---|---|
| PubChem CID | 171715778 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 7-chloro-6-(3,5-dimethoxyanilino)-2-methylquinoline-5,8-dione |
| SMILES | COc1cc(NC2=C(Cl)C(=O)c3nc(C)ccc3C2=O)cc(OC)c1 |
| InChI | InChI=1S/C18H15ClN2O4/c1-9-4-5-13-15(20-9)18(23)14(19)16(17(13)22)21-10-6-11(24-2)8-12(7-10)25-3/h4-8,21H,1-3H3 |
| InChIKey | WBRJOIQTPNSHKG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|