C16H10ClNNaO5S+ — CID 54609602
sodium 4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]benzenesulfonic acid (PubChem CID 54609602) has the molecular formula C16H10ClNNaO5S+ and a molecular weight of 386.77 g/mol. Its IUPAC name is sodium 4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]benzenesulfonic acid.
| Compound Name | sodium 4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 54609602 |
| Molecular Formula | C16H10ClNNaO5S+ |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | sodium 4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]benzenesulfonic acid |
| SMILES | O=C1C(Cl)=C(Nc2ccc(S(=O)(=O)O)cc2)C(=O)c2ccccc21.[Na+] |
| InChI | InChI=1S/C16H10ClNO5S.Na/c17-13-14(16(20)12-4-2-1-3-11(12)15(13)19)18-9-5-7-10(8-6-9)24(21,22)23;/h1-8,18H,(H,21,22,23);/q;+1 |
| InChIKey | IAMWSTWHYJUUBZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|