C22H14ClN3O3 — CID 162655089
4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-N-pyridin-4-ylbenzamide (PubChem CID 162655089) has the molecular formula C22H14ClN3O3 and a molecular weight of 403.83 g/mol. Its IUPAC name is 4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 162655089 |
| Molecular Formula | C22H14ClN3O3 |
| Molecular Weight | 403.83 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-N-pyridin-4-ylbenzamide |
| SMILES | O=C(Nc1ccncc1)c1ccc(NC2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H14ClN3O3/c23-18-19(21(28)17-4-2-1-3-16(17)20(18)27)25-14-7-5-13(6-8-14)22(29)26-15-9-11-24-12-10-15/h1-12,25H,(H,24,26,29) |
| InChIKey | YRDXNRYSGAEWNI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|