C25H17ClN4O3 — CID 126485536
4-[[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]methyl]-N-(1H-indazol-6-yl)benzamide (PubChem CID 126485536) has the molecular formula C25H17ClN4O3 and a molecular weight of 456.89 g/mol. Its IUPAC name is 4-[[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]methyl]-N-(1H-indazol-6-yl)benzamide.
| Compound Name | 4-[[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]methyl]-N-(1H-indazol-6-yl)benzamide |
|---|---|
| PubChem CID | 126485536 |
| Molecular Formula | C25H17ClN4O3 |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 4-[[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]methyl]-N-(1H-indazol-6-yl)benzamide |
| SMILES | O=C(Nc1ccc2cn[nH]c2c1)c1ccc(CNC2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H17ClN4O3/c26-21-22(24(32)19-4-2-1-3-18(19)23(21)31)27-12-14-5-7-15(8-6-14)25(33)29-17-10-9-16-13-28-30-20(16)11-17/h1-11,13,27H,12H2,(H,28,30)(H,29,33) |
| InChIKey | KRAPNJPTGLQHMG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|