C21H14ClN3O3S — CID 126485522
4-[[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]methyl]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 126485522) has the molecular formula C21H14ClN3O3S and a molecular weight of 423.88 g/mol. Its IUPAC name is 4-[[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]methyl]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]methyl]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 126485522 |
| Molecular Formula | C21H14ClN3O3S |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 4-[[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]methyl]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc(CNC2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H14ClN3O3S/c22-16-17(19(27)15-4-2-1-3-14(15)18(16)26)24-11-12-5-7-13(8-6-12)20(28)25-21-23-9-10-29-21/h1-10,24H,11H2,(H,23,25,28) |
| InChIKey | YIFPNDQTOLYZTR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|