C17H14FN3O3S2 — CID 42580746
4-[[(4-fluorophenyl)sulfonylamino]methyl]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 42580746) has the molecular formula C17H14FN3O3S2 and a molecular weight of 391.45 g/mol. Its IUPAC name is 4-[[(4-fluorophenyl)sulfonylamino]methyl]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[[(4-fluorophenyl)sulfonylamino]methyl]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 42580746 |
| Molecular Formula | C17H14FN3O3S2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 4-[[(4-fluorophenyl)sulfonylamino]methyl]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc(CNS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H14FN3O3S2/c18-14-5-7-15(8-6-14)26(23,24)20-11-12-1-3-13(4-2-12)16(22)21-17-19-9-10-25-17/h1-10,20H,11H2,(H,19,21,22) |
| InChIKey | BAZDTCPRUATIMK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |