C26H18ClN3O3 — CID 148721786
2-chloro-3-[[4-[2-(1H-indazol-5-yl)acetyl]phenyl]methylamino]naphthalene-1,4-dione (PubChem CID 148721786) has the molecular formula C26H18ClN3O3 and a molecular weight of 455.90 g/mol. Its IUPAC name is 2-chloro-3-[[4-[2-(1H-indazol-5-yl)acetyl]phenyl]methylamino]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[[4-[2-(1H-indazol-5-yl)acetyl]phenyl]methylamino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 148721786 |
| Molecular Formula | C26H18ClN3O3 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 2-chloro-3-[[4-[2-(1H-indazol-5-yl)acetyl]phenyl]methylamino]naphthalene-1,4-dione |
| SMILES | O=C(Cc1ccc2[nH]ncc2c1)c1ccc(CNC2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H18ClN3O3/c27-23-24(26(33)20-4-2-1-3-19(20)25(23)32)28-13-15-5-8-17(9-6-15)22(31)12-16-7-10-21-18(11-16)14-29-30-21/h1-11,14,28H,12-13H2,(H,29,30) |
| InChIKey | NZFNAUCWOGWNCT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|