C24H16ClN3O5 — CID 157396744
2-chloro-3-[[4-[2-(3-nitro-4-pyridinyl)acetyl]phenyl]methylamino]naphthalene-1,4-dione (PubChem CID 157396744) has the molecular formula C24H16ClN3O5 and a molecular weight of 461.86 g/mol. Its IUPAC name is 2-chloro-3-[[4-[2-(3-nitro-4-pyridinyl)acetyl]phenyl]methylamino]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[[4-[2-(3-nitro-4-pyridinyl)acetyl]phenyl]methylamino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 157396744 |
| Molecular Formula | C24H16ClN3O5 |
| Molecular Weight | 461.86 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2-chloro-3-[[4-[2-(3-nitro-4-pyridinyl)acetyl]phenyl]methylamino]naphthalene-1,4-dione |
| SMILES | O=C(Cc1ccncc1[N+](=O)[O-])c1ccc(CNC2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H16ClN3O5/c25-21-22(24(31)18-4-2-1-3-17(18)23(21)30)27-12-14-5-7-15(8-6-14)20(29)11-16-9-10-26-13-19(16)28(32)33/h1-10,13,27H,11-12H2 |
| InChIKey | BMQTVBVAJUBGAW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|