C27H19ClN2O3 — CID 147193150
2-chloro-3-[[4-[2-(1H-indol-5-yl)acetyl]phenyl]methylamino]naphthalene-1,4-dione (PubChem CID 147193150) has the molecular formula C27H19ClN2O3 and a molecular weight of 454.91 g/mol. Its IUPAC name is 2-chloro-3-[[4-[2-(1H-indol-5-yl)acetyl]phenyl]methylamino]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[[4-[2-(1H-indol-5-yl)acetyl]phenyl]methylamino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 147193150 |
| Molecular Formula | C27H19ClN2O3 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-chloro-3-[[4-[2-(1H-indol-5-yl)acetyl]phenyl]methylamino]naphthalene-1,4-dione |
| SMILES | O=C(Cc1ccc2[nH]ccc2c1)c1ccc(CNC2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C27H19ClN2O3/c28-24-25(27(33)21-4-2-1-3-20(21)26(24)32)30-15-16-5-8-18(9-6-16)23(31)14-17-7-10-22-19(13-17)11-12-29-22/h1-13,29-30H,14-15H2 |
| InChIKey | CBVJXVSMMZLEPN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|