C27H27N3O2 — CID 118150418
(E)-N-hydroxy-3-[4-[[2-(1H-indol-5-yl)ethylamino]methyl]phenyl]-4-phenylbut-2-enamide (PubChem CID 118150418) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-[[2-(1H-indol-5-yl)ethylamino]methyl]phenyl]-4-phenylbut-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-[[2-(1H-indol-5-yl)ethylamino]methyl]phenyl]-4-phenylbut-2-enamide |
|---|---|
| PubChem CID | 118150418 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (E)-N-hydroxy-3-[4-[[2-(1H-indol-5-yl)ethylamino]methyl]phenyl]-4-phenylbut-2-enamide |
| SMILES | O=C(/C=C(\Cc1ccccc1)c1ccc(CNCCc2ccc3[nH]ccc3c2)cc1)NO |
| InChI | InChI=1S/C27H27N3O2/c31-27(30-32)18-25(17-20-4-2-1-3-5-20)23-9-6-22(7-10-23)19-28-14-12-21-8-11-26-24(16-21)13-15-29-26/h1-11,13,15-16,18,28-29,32H,12,14,17,19H2,(H,30,31)/b25-18+ |
| InChIKey | AGUSKYQHCICWDL-XIEYBQDHSA-N |
| XLogP | 4.63 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|