C18H19N3S — CID 59088051
1-(1H-indol-5-ylmethyl)-3-(2-phenylethyl)thiourea (PubChem CID 59088051) has the molecular formula C18H19N3S and a molecular weight of 309.44 g/mol. Its IUPAC name is 1-(1H-indol-5-ylmethyl)-3-(2-phenylethyl)thiourea.
| Compound Name | 1-(1H-indol-5-ylmethyl)-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 59088051 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-(1H-indol-5-ylmethyl)-3-(2-phenylethyl)thiourea |
| SMILES | S=C(NCCc1ccccc1)NCc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C18H19N3S/c22-18(20-10-8-14-4-2-1-3-5-14)21-13-15-6-7-17-16(12-15)9-11-19-17/h1-7,9,11-12,19H,8,10,13H2,(H2,20,21,22) |
| InChIKey | XDEKQABHRXSZAG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|