C18H20N2 — CID 102910859
N-(1H-indol-5-ylmethyl)-1-phenylpropan-2-amine (PubChem CID 102910859) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N-(1H-indol-5-ylmethyl)-1-phenylpropan-2-amine.
| Compound Name | N-(1H-indol-5-ylmethyl)-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 102910859 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-(1H-indol-5-ylmethyl)-1-phenylpropan-2-amine |
| SMILES | CC(Cc1ccccc1)NCc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C18H20N2/c1-14(11-15-5-3-2-4-6-15)20-13-16-7-8-18-17(12-16)9-10-19-18/h2-10,12,14,19-20H,11,13H2,1H3 |
| InChIKey | XVTPQWQUBQZDTI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |