C15H23N3 — CID 102910480
3-N-(1H-indol-5-ylmethyl)-1-N,1-N-dimethylbutane-1,3-diamine (PubChem CID 102910480) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-N-(1H-indol-5-ylmethyl)-1-N,1-N-dimethylbutane-1,3-diamine.
| Compound Name | 3-N-(1H-indol-5-ylmethyl)-1-N,1-N-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 102910480 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 3-N-(1H-indol-5-ylmethyl)-1-N,1-N-dimethylbutane-1,3-diamine |
| SMILES | CC(CCN(C)C)NCc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C15H23N3/c1-12(7-9-18(2)3)17-11-13-4-5-15-14(10-13)6-8-16-15/h4-6,8,10,12,16-17H,7,9,11H2,1-3H3 |
| InChIKey | RLXDYAIAUFTANY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |