C27H18ClN3O3 — CID 126485549
4-[[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]methyl]-N-quinolin-5-ylbenzamide (PubChem CID 126485549) has the molecular formula C27H18ClN3O3 and a molecular weight of 467.91 g/mol. Its IUPAC name is 4-[[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]methyl]-N-quinolin-5-ylbenzamide.
| Compound Name | 4-[[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]methyl]-N-quinolin-5-ylbenzamide |
|---|---|
| PubChem CID | 126485549 |
| Molecular Formula | C27H18ClN3O3 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 4-[[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]methyl]-N-quinolin-5-ylbenzamide |
| SMILES | O=C(Nc1cccc2ncccc12)c1ccc(CNC2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C27H18ClN3O3/c28-23-24(26(33)19-6-2-1-5-18(19)25(23)32)30-15-16-10-12-17(13-11-16)27(34)31-22-9-3-8-21-20(22)7-4-14-29-21/h1-14,30H,15H2,(H,31,34) |
| InChIKey | MQPRRXYFFQNUKW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|