C25H18ClNO4 — CID 148898004
2-chloro-3-[[4-[2-(4-hydroxyphenyl)acetyl]phenyl]methylamino]naphthalene-1,4-dione (PubChem CID 148898004) has the molecular formula C25H18ClNO4 and a molecular weight of 431.88 g/mol. Its IUPAC name is 2-chloro-3-[[4-[2-(4-hydroxyphenyl)acetyl]phenyl]methylamino]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[[4-[2-(4-hydroxyphenyl)acetyl]phenyl]methylamino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 148898004 |
| Molecular Formula | C25H18ClNO4 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-chloro-3-[[4-[2-(4-hydroxyphenyl)acetyl]phenyl]methylamino]naphthalene-1,4-dione |
| SMILES | O=C(Cc1ccc(O)cc1)c1ccc(CNC2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H18ClNO4/c26-22-23(25(31)20-4-2-1-3-19(20)24(22)30)27-14-16-5-9-17(10-6-16)21(29)13-15-7-11-18(28)12-8-15/h1-12,27-28H,13-14H2 |
| InChIKey | PGFWNFUAGPUZHL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|