C25H18N4O5 — CID 4174611
N-[3-hydroxy-1-(1H-indazol-6-ylamino)-1-oxopropan-2-yl]-9,10-dioxoanthracene-2-carboxamide (PubChem CID 4174611) has the molecular formula C25H18N4O5 and a molecular weight of 454.44 g/mol. Its IUPAC name is N-[3-hydroxy-1-(1H-indazol-6-ylamino)-1-oxopropan-2-yl]-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | N-[3-hydroxy-1-(1H-indazol-6-ylamino)-1-oxopropan-2-yl]-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 4174611 |
| Molecular Formula | C25H18N4O5 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-[3-hydroxy-1-(1H-indazol-6-ylamino)-1-oxopropan-2-yl]-9,10-dioxoanthracene-2-carboxamide |
| SMILES | O=C(NC(CO)C(=O)Nc1ccc2cn[nH]c2c1)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H18N4O5/c30-12-21(25(34)27-15-7-5-14-11-26-29-20(14)10-15)28-24(33)13-6-8-18-19(9-13)23(32)17-4-2-1-3-16(17)22(18)31/h1-11,21,30H,12H2,(H,26,29)(H,27,34)(H,28,33) |
| InChIKey | SMSIEVQJEOGFET-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 141.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|