C26H28N2O5 — CID 6723334
N-[(2S)-1-(cyclooctylamino)-3-hydroxy-1-oxopropan-2-yl]-9,10-dioxoanthracene-2-carboxamide (PubChem CID 6723334) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[(2S)-1-(cyclooctylamino)-3-hydroxy-1-oxopropan-2-yl]-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | N-[(2S)-1-(cyclooctylamino)-3-hydroxy-1-oxopropan-2-yl]-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 6723334 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-[(2S)-1-(cyclooctylamino)-3-hydroxy-1-oxopropan-2-yl]-9,10-dioxoanthracene-2-carboxamide |
| SMILES | O=C(N[C@@H](CO)C(=O)NC1CCCCCCC1)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H28N2O5/c29-15-22(26(33)27-17-8-4-2-1-3-5-9-17)28-25(32)16-12-13-20-21(14-16)24(31)19-11-7-6-10-18(19)23(20)30/h6-7,10-14,17,22,29H,1-5,8-9,15H2,(H,27,33)(H,28,32)/t22-/m0/s1 |
| InChIKey | NQUOAGDTZWBURB-QFIPXVFZSA-N |
| XLogP | 2.78 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|