C25H19ClN2O4S — CID 122193901
2-chloro-3-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)anilino]naphthalene-1,4-dione (PubChem CID 122193901) has the molecular formula C25H19ClN2O4S and a molecular weight of 478.96 g/mol. Its IUPAC name is 2-chloro-3-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)anilino]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)anilino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 122193901 |
| Molecular Formula | C25H19ClN2O4S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 2-chloro-3-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)anilino]naphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(Nc2ccc(S(=O)(=O)N3CCc4ccccc4C3)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C25H19ClN2O4S/c26-22-23(25(30)21-8-4-3-7-20(21)24(22)29)27-18-9-11-19(12-10-18)33(31,32)28-14-13-16-5-1-2-6-17(16)15-28/h1-12,27H,13-15H2 |
| InChIKey | RISYDKGLMVEQNI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|