C18H15N5O2S — CID 169339338
2-[[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169339338) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is 2-[[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169339338 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-[[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1ccc(S(=O)(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C18H15N5O2S/c19-11-17(12-20)22-21-16-5-7-18(8-6-16)26(24,25)23-10-9-14-3-1-2-4-15(14)13-23/h1-8,21H,9-10,13H2 |
| InChIKey | AXUGUJCEXSVUIA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|