C28H22N2O4S — CID 24685944
N-dibenzofuran-2-yl-4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzamide (PubChem CID 24685944) has the molecular formula C28H22N2O4S and a molecular weight of 482.56 g/mol. Its IUPAC name is N-dibenzofuran-2-yl-4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzamide.
| Compound Name | N-dibenzofuran-2-yl-4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzamide |
|---|---|
| PubChem CID | 24685944 |
| Molecular Formula | C28H22N2O4S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-dibenzofuran-2-yl-4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzamide |
| SMILES | O=C(Nc1ccc2oc3ccccc3c2c1)c1ccc(S(=O)(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C28H22N2O4S/c31-28(29-22-11-14-27-25(17-22)24-7-3-4-8-26(24)34-27)20-9-12-23(13-10-20)35(32,33)30-16-15-19-5-1-2-6-21(19)18-30/h1-14,17H,15-16,18H2,(H,29,31) |
| InChIKey | PDITXNRCJDEMAW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |