C24H24N2O5S2 — CID 30841105
3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-(4-ethylsulfonylphenyl)benzamide (PubChem CID 30841105) has the molecular formula C24H24N2O5S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-(4-ethylsulfonylphenyl)benzamide.
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-(4-ethylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 30841105 |
| Molecular Formula | C24H24N2O5S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-(4-ethylsulfonylphenyl)benzamide |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)c2cccc(S(=O)(=O)N3CCc4ccccc4C3)c2)cc1 |
| InChI | InChI=1S/C24H24N2O5S2/c1-2-32(28,29)22-12-10-21(11-13-22)25-24(27)19-8-5-9-23(16-19)33(30,31)26-15-14-18-6-3-4-7-20(18)17-26/h3-13,16H,2,14-15,17H2,1H3,(H,25,27) |
| InChIKey | YCGGKNPGFWNHQZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |