C20H24N2O3S — CID 17418791
3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-diethylbenzamide (PubChem CID 17418791) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-diethylbenzamide.
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 17418791 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(S(=O)(=O)N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C20H24N2O3S/c1-3-21(4-2)20(23)17-10-7-11-19(14-17)26(24,25)22-13-12-16-8-5-6-9-18(16)15-22/h5-11,14H,3-4,12-13,15H2,1-2H3 |
| InChIKey | ZSNDCHHAOZKGOF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |